CymitQuimica logo

CAS 930-83-6

:

4,5-dimethyl-1,2-oxazol-3(2H)-one

Description:
4,5-Dimethyl-1,2-oxazol-3(2H)-one, with the CAS number 930-83-6, is a heterocyclic organic compound characterized by its oxazole ring structure, which contains both nitrogen and oxygen atoms. This compound features two methyl groups attached to the 4 and 5 positions of the oxazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of the oxazole moiety suggests potential applications in pharmaceuticals and agrochemicals, as oxazoles are known for their biological activity. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to the reactivity of the oxazole ring. Its stability and reactivity can be influenced by the substituents on the ring, making it a subject of interest in synthetic organic chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C5H7NO2
InChI:InChI=1/C5H7NO2/c1-3-4(2)8-6-5(3)7/h1-2H3,(H,6,7)
SMILES:Cc1c(C)onc1O
Synonyms:
  • 3-Isoxazolol, 4,5-Dimethyl-
  • 4,5-Dimethyl-1,2-oxazol-3-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.