CAS 93002-99-4

6-(3-bromophenyl)-6-oxo-hexanoic acid

Description:

6-(3-Bromophenyl)-6-oxo-hexanoic acid, with the CAS number 93002-99-4, is an organic compound characterized by its unique structure that includes a hexanoic acid backbone with a ketone functional group and a bromophenyl substituent. This compound typically exhibits properties associated with both carboxylic acids and aromatic compounds, such as solubility in organic solvents and potential reactivity due to the presence of the bromine atom, which can influence its electrophilic and nucleophilic behavior. The presence of the ketone group contributes to its reactivity, allowing for potential applications in organic synthesis and medicinal chemistry. Additionally, the bromophenyl moiety may impart specific biological activities or enhance the compound's interaction with biological targets. Overall, this compound's characteristics make it of interest in various fields, including pharmaceuticals and materials science, where its unique functional groups can be exploited for diverse applications.

Formula: C₁₂H₁₃BrO₃

InChI: InChI=1/C12H13BrO3/c13-10-5-3-4-9(8-10)11(14)6-1-2-7-12(15)16/h3-5,8H,1-2,6-7H2,(H,15,16)

SMILES: C(CCC(=O)O)CC(=O)c1cccc(c1)Br