CymitQuimica logo

CAS 930110-98-8

:

5-(1-Pyrrolidinyl)-2-pyridinemethanol

Description:
5-(1-Pyrrolidinyl)-2-pyridinemethanol, with the CAS number 930110-98-8, is a chemical compound characterized by its unique structure, which includes a pyridine ring and a pyrrolidine moiety. This compound typically exhibits properties associated with both heterocyclic amines and alcohols, making it a potential candidate for various applications in medicinal chemistry and drug development. The presence of the hydroxyl (-OH) group suggests it may engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the pyrrolidine ring can contribute to its biological activity, potentially affecting its interaction with biological targets. The compound's molecular structure may allow it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the purity and specific conditions under which it is studied. Overall, 5-(1-Pyrrolidinyl)-2-pyridinemethanol represents a versatile structure with potential implications in pharmacology and organic synthesis.
Formula:C10H14N2O
InChI:InChI=1S/C10H14N2O/c13-8-9-3-4-10(7-11-9)12-5-1-2-6-12/h3-4,7,13H,1-2,5-6,8H2
InChI key:InChIKey=GLWULQJNDPJFDR-UHFFFAOYSA-N
SMILES:C(O)C=1C=CC(=CN1)N2CCCC2
Synonyms:
  • 5-(1-Pyrrolidinyl)-2-pyridinemethanol
  • 2-Pyridinemethanol, 5-(1-pyrrolidinyl)-
Found 3 products.