CymitQuimica logo

CAS 930298-25-2

:

(5-amino-4-chloro-2-methyl-phenyl) ethyl carbonate

Description:
(5-amino-4-chloro-2-methyl-phenyl) ethyl carbonate, identified by its CAS number 930298-25-2, is a chemical compound characterized by its unique functional groups and structural features. It contains an amino group (-NH2), a chloro substituent (-Cl), and a carbonate moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the aromatic ring, specifically a substituted phenyl group, suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The ethyl carbonate part of the molecule indicates that it may have applications in medicinal chemistry or as an intermediate in the synthesis of more complex organic compounds. Additionally, the specific arrangement of substituents on the phenyl ring can influence its solubility, stability, and biological activity. Overall, this compound's characteristics make it a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C10H12ClNO3
InChI:InChI=1/C10H12ClNO3/c1-3-14-10(13)15-9-5-8(12)7(11)4-6(9)2/h4-5H,3,12H2,1-2H3
SMILES:CCOC(=O)Oc1cc(c(cc1C)Cl)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.