CAS 930298-26-3
:(4-chloro-5-iodo-2-methyl-phenyl) ethyl carbonate
Description:
(4-Chloro-5-iodo-2-methyl-phenyl) ethyl carbonate is an organic compound characterized by its unique functional groups and structural features. It contains a phenyl ring substituted with chlorine and iodine atoms, which can influence its reactivity and biological activity. The presence of the ethyl carbonate moiety suggests that it may exhibit properties typical of esters, such as being a potential solvent or reagent in organic synthesis. The chlorine and iodine substituents can enhance the compound's lipophilicity, potentially affecting its solubility in organic solvents and its interaction with biological systems. Additionally, the methyl group on the phenyl ring can introduce steric hindrance, which may influence the compound's reactivity and stability. Overall, this compound may have applications in pharmaceuticals or agrochemicals, but its specific properties, such as melting point, boiling point, and reactivity, would require further investigation through experimental data. Safety and handling considerations should also be taken into account due to the presence of halogenated substituents.
Formula:C10H10ClIO3
InChI:InChI=1/C10H10ClIO3/c1-3-14-10(13)15-9-5-8(12)7(11)4-6(9)2/h4-5H,3H2,1-2H3
SMILES:CCOC(=O)Oc1cc(c(cc1C)Cl)I
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

