CymitQuimica logo

CAS 930395-62-3

:

2-Chloro-N-(3-chloro-2-methylphenyl)propanamide

Description:
2-Chloro-N-(3-chloro-2-methylphenyl)propanamide is a chemical compound characterized by its amide functional group, which is derived from propanoic acid. The presence of two chlorine atoms on the aromatic ring and the aliphatic chain contributes to its unique reactivity and potential applications in various chemical processes. This compound typically exhibits moderate solubility in organic solvents, reflecting its hydrophobic nature due to the aromatic structure. The chlorinated phenyl group may enhance its biological activity, making it of interest in pharmaceutical research. Additionally, the presence of the amide functional group suggests potential for hydrogen bonding, influencing its physical properties such as melting and boiling points. Safety considerations are important when handling this compound, as chlorinated compounds can pose environmental and health risks. Overall, 2-Chloro-N-(3-chloro-2-methylphenyl)propanamide is a notable compound in organic synthesis and medicinal chemistry, warranting further investigation for its potential applications.
Formula:C10H11Cl2NO
InChI:InChI=1S/C10H11Cl2NO/c1-6-8(12)4-3-5-9(6)13-10(14)7(2)11/h3-5,7H,1-2H3,(H,13,14)
InChI key:InChIKey=WYZJPDWXOMIWMT-UHFFFAOYSA-N
SMILES:N(C(C(C)Cl)=O)C1=C(C)C(Cl)=CC=C1
Synonyms:
  • 2-Chloro-N-(3-chloro-2-methyl-phenyl)-propionamide
  • Propanamide, 2-chloro-N-(3-chloro-2-methylphenyl)-
  • 2-Chloro-N-(3-chloro-2-methylphenyl)propanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.