CymitQuimica logo

CAS 930395-68-9

:

2-Chloro-N-(8-chloro-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)acetamide

Description:
2-Chloro-N-(8-chloro-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)acetamide is a chemical compound characterized by its complex structure, which includes a chloro-substituted benzodioxepin moiety. This compound features a chloro group attached to a benzodioxepin ring, contributing to its unique chemical properties. The presence of the acetamide functional group indicates that it can participate in various chemical reactions typical of amides, such as hydrolysis and acylation. The compound's molecular structure suggests potential biological activity, which may be explored in pharmacological contexts. Its specific interactions with biological targets would depend on its conformation and the presence of functional groups that can engage in hydrogen bonding or other intermolecular forces. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the chloro substituents and the overall electronic distribution within the molecule. As with many synthetic organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H11Cl2NO3
InChI:InChI=1S/C11H11Cl2NO3/c12-6-11(15)14-8-5-10-9(4-7(8)13)16-2-1-3-17-10/h4-5H,1-3,6H2,(H,14,15)
InChI key:InChIKey=JGDWWKNQQXJVIA-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)C=1C=C2C(=CC1Cl)OCCCO2
Synonyms:
  • 2-Chloro-N-(8-chloro-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)acetamide
  • Acetamide, 2-chloro-N-(8-chloro-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.