CAS 930395-99-6

6-Chloro-1,2,3,4-tetrahydro-1-methylpyrrolo[1,2-a]pyrazine

Description:

6-Chloro-1,2,3,4-tetrahydro-1-methylpyrrolo[1,2-a]pyrazine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrrole and a pyrazine moiety. The presence of a chlorine atom at the 6-position contributes to its reactivity and potential biological activity. This compound is typically a colorless to pale yellow solid, exhibiting moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of nitrogen atoms that can participate in hydrogen bonding and coordination with biological targets. The tetrahydro configuration indicates that it is a saturated derivative, which may influence its stability and reactivity compared to unsaturated analogs. Additionally, the methyl group at the 1-position can affect its lipophilicity and overall pharmacokinetic properties. As with many heterocycles, the compound's properties can be influenced by substituents, making it a subject of interest for further research in various chemical and biological contexts.

Formula: C₈H₁₁ClN₂

InChI: InChI=1S/C8H11ClN2/c1-6-7-2-3-8(9)11(7)5-4-10-6/h2-3,6,10H,4-5H2,1H3

InChI key: InChIKey=XXVWOUMHIVZHED-UHFFFAOYSA-N

SMILES: CC1C=2N(C(Cl)=CC2)CCN1

Synonyms:

• 6-Chloro-1-methyl-1,2,3,4-tetrahydropyrrolo[1,2-〈a]pyrazine
• Pyrrolo[1,2-a]pyrazine, 6-chloro-1,2,3,4-tetrahydro-1-methyl-
• 6-Chloro-1-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine
• 6-Chloro-1,2,3,4-tetrahydro-1-methylpyrrolo[1,2-a]pyrazine