CAS 930396-10-4

N-(3,4-Diethoxyphenyl)thiourea

Description:

N-(3,4-Diethoxyphenyl)thiourea is an organic compound characterized by the presence of a thiourea functional group and a diethoxy-substituted phenyl ring. Its molecular structure features a thiourea moiety, which consists of a carbon atom double-bonded to a sulfur atom and single-bonded to an amine group, contributing to its potential as a nucleophile in various chemical reactions. The diethoxy substitution on the phenyl ring enhances its solubility in organic solvents and may influence its reactivity and biological activity. This compound may exhibit properties such as moderate stability under standard conditions, and it could participate in various chemical transformations, including condensation and substitution reactions. Additionally, compounds with thiourea groups are often studied for their potential applications in medicinal chemistry, agrochemicals, and materials science due to their ability to form hydrogen bonds and interact with biological targets. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₁H₁₆N₂O₂S

InChI: InChI=1S/C11H16N2O2S/c1-3-14-9-6-5-8(13-11(12)16)7-10(9)15-4-2/h5-7H,3-4H2,1-2H3,(H3,12,13,16)

InChI key: InChIKey=RVYNTSSFWGHQQW-UHFFFAOYSA-N

SMILES: O(CC)C1=C(OCC)C=CC(NC(N)=S)=C1

Synonyms:

• N-(3,4-Diethoxyphenyl)thiourea
• Thiourea, N-(3,4-diethoxyphenyl)-