CymitQuimica logo

CAS 930396-15-9

:

1,3-Dichloro-7-isoquinolinesulfonyl chloride

Description:
1,3-Dichloro-7-isoquinolinesulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and utility in organic synthesis. This compound features a dichloro substitution pattern on the isoquinoline ring, contributing to its unique chemical properties. It is typically used as a reagent in various chemical reactions, particularly in the synthesis of sulfonamides and other derivatives. The presence of chlorine atoms enhances its electrophilic character, making it a valuable intermediate in the development of pharmaceuticals and agrochemicals. Additionally, the sulfonyl chloride group is known for its ability to react with amines and alcohols, facilitating the formation of sulfonamides and sulfonate esters. Due to its reactive nature, handling this compound requires appropriate safety precautions, including the use of personal protective equipment and working in a well-ventilated area or fume hood. Overall, 1,3-Dichloro-7-isoquinolinesulfonyl chloride is an important building block in synthetic organic chemistry.
Formula:C9H4Cl3NO2S
InChI:InChI=1S/C9H4Cl3NO2S/c10-8-3-5-1-2-6(16(12,14)15)4-7(5)9(11)13-8/h1-4H
InChI key:InChIKey=ITORBCGERYBPLT-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(Cl)N1)C=CC(S(Cl)(=O)=O)=C2
Synonyms:
  • 7-Isoquinolinesulfonyl chloride, 1,3-dichloro-
  • 1,3-Dichloro-7-isoquinolinesulfonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.