CymitQuimica logo

CAS 93057-16-0

:

2'-deoxy-5-fluoro-3',5'-bis-O-[(4-methoxyphenoxy)carbonyl]-3-(4-propoxybenzoyl)uridine

Description:
2'-Deoxy-5-fluoro-3',5'-bis-O-[(4-methoxyphenoxy)carbonyl]-3-(4-propoxybenzoyl)uridine is a synthetic nucleoside analog that exhibits structural modifications to enhance its pharmacological properties. This compound features a deoxyribose sugar moiety, a fluorine atom at the 5-position of the uracil base, and two esterified carbonyl groups derived from 4-methoxyphenol and 4-propoxybenzoic acid. These modifications can influence its solubility, stability, and interaction with biological targets, potentially enhancing its efficacy as an antiviral or anticancer agent. The presence of the fluorine atom may also contribute to increased resistance to enzymatic degradation. The compound's complex structure suggests potential for specific interactions with nucleic acid targets, making it a candidate for further research in medicinal chemistry. Its CAS number, 93057-16-0, allows for precise identification in chemical databases, facilitating studies on its synthesis, biological activity, and therapeutic applications. Overall, this compound represents a significant interest in the development of novel therapeutic agents.
Formula:C35H33FN2O13
InChI:InChI=1/C35H33FN2O13/c1-4-17-46-24-7-5-21(6-8-24)31(39)38-32(40)27(36)19-37(33(38)41)30-18-28(51-35(43)49-26-15-11-23(45-3)12-16-26)29(50-30)20-47-34(42)48-25-13-9-22(44-2)10-14-25/h5-16,19,28-30H,4,17-18,20H2,1-3H3/t28-,29+,30+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.