CAS 930570-34-6

6-bromo-4-chloro-2-propyl-quinoline

Description:

6-Bromo-4-chloro-2-propyl-quinoline is a heterocyclic organic compound characterized by its quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 6 and 4 positions, respectively, introduces significant reactivity and influences its chemical properties. The propyl group at the 2-position contributes to its hydrophobic character, affecting its solubility in various solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the presence of halogens can enhance its reactivity in electrophilic substitution reactions, making it a versatile intermediate in organic synthesis. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds. Overall, 6-bromo-4-chloro-2-propyl-quinoline represents a unique structure with diverse applications in research and industry.

Formula: C₁₂H₁₁BrClN

InChI: InChI=1/C12H11BrClN/c1-2-3-9-7-11(14)10-6-8(13)4-5-12(10)15-9/h4-7H,2-3H2,1H3

SMILES: CCCc1cc(c2cc(ccc2n1)Br)Cl

Synonyms:

• 6-Bromo-4-Chloro-2-Propylquinoline
• Quinoline, 6-bromo-4-chloro-2-propyl-
• T66 Bnj C3 Eg He

6-Bromo-4-chloro-2-propylquinoline

CAS: 930570-34-6

6-Bromo-4-chloro-2-propylquinoline

Purity: ≥95%

Molecular weight: 284.58g/mol

Ref: 54-OR307870