CymitQuimica logo

CAS 930604-26-5

:

1,4′-Bipiperidine, 4-methoxy-, hydrochloride (1:2)

Description:
1,4′-Bipiperidine, 4-methoxy-, hydrochloride (1:2) is a chemical compound characterized by its bipiperidine structure, which consists of two piperidine rings connected by a carbon chain. The presence of a methoxy group at the 4-position of one of the piperidine rings contributes to its unique properties, including potential solubility in organic solvents and water. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure suggests potential interactions with various biological targets, which could lead to applications in drug development. The CAS number 930604-26-5 uniquely identifies this substance, facilitating its recognition in scientific literature and databases. Safety and handling precautions should be observed, as with any chemical, due to potential toxicity or reactivity. Overall, 1,4′-Bipiperidine, 4-methoxy-, hydrochloride (1:2) represents a compound with intriguing chemical properties and potential applications in research and industry.
Formula:C11H22N2O·2ClH
InChI:InChI=1S/C11H22N2O.2ClH/c1-14-11-4-8-13(9-5-11)10-2-6-12-7-3-10;;/h10-12H,2-9H2,1H3;2*1H
InChI key:InChIKey=YKSPUBYLVRXPQD-UHFFFAOYSA-N
SMILES:O(C)C1CCN(CC1)C2CCNCC2.Cl
Synonyms:
  • 1,4′-Bipiperidine, 4-methoxy-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.