CymitQuimica logo

CAS 93073-14-4

:

4-amino-5-(4-methoxybenzyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:
4-amino-5-(4-methoxybenzyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an amino group and a thione functional group, contributing to its reactivity and potential biological activity. The presence of the 4-methoxybenzyl substituent enhances its lipophilicity, which may influence its pharmacokinetic properties. Typically, compounds of this nature are investigated for their potential applications in pharmaceuticals, particularly as antimicrobial or antifungal agents, due to the presence of the triazole moiety, which is known for its ability to inhibit certain enzymes in pathogens. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its molecular structure suggests potential interactions with biological targets, making it a candidate for further research in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C10H12N4OS
InChI:InChI=1/C10H12N4OS/c1-15-8-4-2-7(3-5-8)6-9-12-13-10(16)14(9)11/h2-5H,6,11H2,1H3,(H,13,16)
SMILES:COc1ccc(cc1)Cc1nnc(n1N)S
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.