CAS 93073-37-1

5-(4-methoxybenzyl)-1,3,4-oxadiazole-2(3H)-thione

Description:

5-(4-Methoxybenzyl)-1,3,4-oxadiazole-2(3H)-thione is a heterocyclic compound characterized by the presence of an oxadiazole ring, which is a five-membered ring containing two nitrogen atoms and three carbon atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom within the oxadiazole structure. The methoxybenzyl substituent enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature exhibit interesting pharmacological properties, including potential antimicrobial, antifungal, or anticancer activities, due to the presence of the oxadiazole moiety. The thione group can also participate in various chemical reactions, making this compound versatile in synthetic chemistry. Its solubility and stability can vary based on the solvent and environmental conditions, which are important considerations for its application in research and industry. Overall, this compound represents a class of organic molecules that are of interest in medicinal chemistry and material science.

Formula: C₁₀H₁₀N₂O₂S

InChI: InChI=1/C10H10N2O2S/c1-13-8-4-2-7(3-5-8)6-9-11-12-10(15)14-9/h2-5H,6H2,1H3,(H,12,15)

SMILES: COc1ccc(cc1)Cc1nnc(o1)S

Synonyms:

• 1,3,4-Oxadiazole-2-thiol, 5-[(4-methoxyphenyl)methyl]-
• 5-(4-Methoxybenzyl)-1,3,4-oxadiazole-2-thiol

5-[(4-Methoxyphenyl)methyl]-1,3,4-oxadiazole-2-thiol

CAS: 93073-37-1

Versatile small molecule scaffold

Formula: C₁₀H₁₀N₂O₂S

Purity: Min. 95%

Molecular weight: 222.27 g/mol

Ref: 3D-TDA07337