CymitQuimica logo

CAS 93075-77-5

:

1,2-Bis[2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]ethoxy]benzene

Description:
1,2-Bis[2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]ethoxy]benzene, with CAS number 93075-77-5, is a synthetic organic compound characterized by its complex structure featuring a benzene ring substituted with multiple ethoxy groups and a chloroethoxy moiety. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for compounds with long alkyl chains. The presence of the chloroethoxy group suggests potential reactivity, particularly in nucleophilic substitution reactions. Additionally, the compound may demonstrate surface-active properties, making it of interest in applications such as surfactants or emulsifiers. Its molecular structure indicates potential uses in various fields, including pharmaceuticals, agrochemicals, and materials science. However, safety and handling precautions should be observed due to the presence of chlorine, which can impart toxicity and environmental concerns.
Formula:C22H36Cl2O8
InChI:InChI=1S/C22H36Cl2O8/c23-5-7-25-9-11-27-13-15-29-17-19-31-21-3-1-2-4-22(21)32-20-18-30-16-14-28-12-10-26-8-6-24/h1-4H,5-20H2
InChI key:InChIKey=PWUULNCLJFWXGY-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCCl)C1=C(OCCOCCOCCOCCCl)C=CC=C1
Synonyms:
  • Benzene, 1,2-bis[2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]ethoxy]-
  • 1,2-Bis[2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]ethoxy]benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.