CAS 930783-26-9
:(9aR)-Hexahydropyrazino[2,1-c][1,4]oxazin-4(3H)-one
Description:
(9aR)-Hexahydropyrazino[2,1-c][1,4]oxazin-4(3H)-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrazine and an oxazine moiety. This compound features a saturated ring system, contributing to its stability and potential biological activity. The presence of the oxazinone functional group suggests that it may exhibit properties typical of lactams, such as being a potential precursor for further chemical transformations. Its stereochemistry, indicated by the (9aR) designation, implies specific spatial arrangements of atoms that can influence its reactivity and interactions with biological targets. The compound's CAS number, 930783-26-9, allows for precise identification in chemical databases, facilitating research and application in fields such as medicinal chemistry and drug development. While specific physical properties like melting point, boiling point, and solubility are not detailed here, compounds of this nature often exhibit moderate to high polarity, influencing their solubility in various solvents and their behavior in biological systems.
Formula:C7H12N2O2
InChI:InChI=1S/C7H12N2O2/c10-7-5-11-4-6-3-8-1-2-9(6)7/h6,8H,1-5H2/t6-/m1/s1
InChI key:InChIKey=MTCWTJKARNZOLR-ZCFIWIBFSA-N
SMILES:O=C1N2[C@@](COC1)(CNCC2)[H]
Synonyms:- (9AR)-Hexahydropyrazino[2,1-c][1,4]oxazin-4(3H)-one
- (9aR)-Hexahydropyrazino[2,1-c][1,4]oxazin-4(3H)-one
- (9AR)-Hexahydropyrazino-[2,1-c][1,4]oxazin-4(3H)-one
- Pyrazino[2,1-c][1,4]oxazin-4(3H)-one, hexahydro-, (9aR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.