CAS 930790-54-8

5-Chloro-7-methyl-1H-pyrrolo[2,3-c]pyridine

Description:

5-Chloro-7-methyl-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings. This compound features a chlorine atom at the 5-position and a methyl group at the 7-position of the pyrrolo structure, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent characteristics. The presence of the chlorine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which makes it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, and it may serve as a scaffold for the synthesis of more complex molecules. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.

Formula: C₈H₇ClN₂

InChI: InChI=1S/C8H7ClN2/c1-5-8-6(2-3-10-8)4-7(9)11-5/h2-4,10H,1H3

SMILES: Cc1c2c(cc[nH]2)cc(Cl)n1

Synonyms:

• 1H-Pyrrolo[2,3-c]pyridine, 5-chloro-7-methyl-
• 5-Chloro-7-Methyl-6-Azaindole

5-Chloro-7-methyl-1H-pyrrolo[2,3-c]pyridine

CAS: 930790-54-8

Formula: C₈H₇ClN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 166.6076

Ref: IN-DA00IHH2

5-Chloro-7-methyl-1H-pyrrolo[2,3-c]pyridine

CAS: 930790-54-8

5-Chloro-7-methyl-1H-pyrrolo[2,3-c]pyridine

Purity: ≥95%

Molecular weight: 166.61g/mol

Ref: 54-OR305531

5-Chloro-7-methyl-1H-pyrrolo[2,3-c]pyridine

CAS: 930790-54-8

Formula: C₈H₇ClN₂

Purity: 95.0%

Molecular weight: 166.61

Ref: 10-F305377