CAS 930798-25-7

(6-chloropyrazin-2-yl)acetic acid

Description:

(6-Chloropyrazin-2-yl)acetic acid is a chemical compound characterized by its pyrazine ring structure, which is substituted with a chlorine atom at the 6-position and an acetic acid functional group at the 2-position. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, including potential acidity due to the carboxylic group. The presence of the chlorine atom can influence the compound's reactivity, solubility, and biological activity. It may be soluble in polar solvents, and its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's unique characteristics may also allow for interactions with biological targets, making it of interest in drug discovery and development. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, and it may be subject to various regulatory considerations depending on its intended use. Overall, (6-chloropyrazin-2-yl)acetic acid represents a versatile building block in organic synthesis and medicinal chemistry.

Formula: C₆H₅ClN₂O₂

InChI: InChI=1/C6H5ClN2O2/c7-5-3-8-2-4(9-5)1-6(10)11/h2-3H,1H2,(H,10,11)

SMILES: C(c1cncc(Cl)n1)C(=O)O

Synonyms:

• 2-Pyrazineacetic Acid, 6-Chloro-
• (6-Chloropyrazin-2-yl)acetic acid

(6-Chloropyrazin-2-yl)acetic acid

CAS: 930798-25-7

Formula: C₆H₅ClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 172.5691

Ref: IN-DA00H5EX

(6-Chloropyrazin-2-yl)acetic acid

CAS: 930798-25-7

(6-Chloropyrazin-2-yl)acetic acid

Purity: 97%

Molecular weight: 172.57g/mol

Ref: 54-OR905690

(6-Chloropyrazin-2-yl)acetic acid

CAS: 930798-25-7

Formula: C₆H₅ClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 172.57

Ref: 10-F076769