CymitQuimica logo

CAS 93087-37-7

:

[2,6-diiodo-4-[(E)-(2-methyl-5-oxo-oxazol-4-ylidene)methyl]phenyl] acetate

Description:
[2,6-Diiodo-4-[(E)-(2-methyl-5-oxo-oxazol-4-ylidene)methyl]phenyl] acetate is a chemical compound characterized by its complex structure, which includes a phenyl ring substituted with two iodine atoms and an acetate group, as well as a side chain featuring an oxazole derivative. The presence of iodine atoms typically enhances the compound's reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The oxazole moiety contributes to the compound's potential as a bioactive agent, possibly exhibiting antimicrobial or anticancer properties. The E configuration of the double bond in the side chain suggests a specific geometric arrangement that may affect the compound's interactions with biological targets. Additionally, the acetate group can influence solubility and stability in various solvents. Overall, this compound's unique structural features may provide avenues for research in drug development and materials science, although specific applications would depend on further empirical studies.
Formula:C13H9I2NO4
InChI:InChI=1/C13H9I2NO4/c1-6-16-11(13(18)19-6)5-8-3-9(14)12(10(15)4-8)20-7(2)17/h3-5H,1-2H3/b11-5+
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • 4-[[4-(Acetyloxy)-3,5-diiodophenyl]methylene]-2-methyl-5(4H)-oxazolone (E/Z Mixture)

    Controlled Product
    CAS:
    <p>Applications 4-[[4-(Acetyloxy)-3,5-diiodophenyl]methylene]-2-methyl-5(4H)-oxazolone _x000D_(E/Z Mixture) (cas# 93087-37-7) is a compound useful in organic synthesis.<br></p>
    Formula:C13H9I2NO4
    Color and Shape:Neat
    Molecular weight:497.02

    Ref: TR-A165350

    1g
    1,738.00€
    100mg
    259.00€