CAS 93088-18-7

1-(3,4-dimethoxybenzyl)piperazine dihydrochloride

Description:

1-(3,4-Dimethoxybenzyl)piperazine dihydrochloride is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of the 3,4-dimethoxybenzyl group indicates that the compound has two methoxy (-OCH3) substituents on a benzyl moiety, contributing to its lipophilicity and potential biological activity. As a dihydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmacological research. The compound may exhibit properties such as acting as a ligand for certain receptors, and its structural features suggest potential interactions with neurotransmitter systems. Its synthesis and characterization involve standard organic chemistry techniques, and it is important to handle it with care due to potential biological effects. Overall, this compound is of interest in medicinal chemistry and may serve as a lead compound for further drug development.

Formula: C₁₃H₂₂Cl₂N₂O₂

InChI: InChI=1/C13H20N2O2.2ClH/c1-16-12-4-3-11(9-13(12)17-2)10-15-7-5-14-6-8-15;;/h3-4,9,14H,5-8,10H2,1-2H3;2*1H

SMILES: COc1ccc(cc1OC)CN1CCNCC1.Cl.Cl