CymitQuimica logo

CAS 93099-59-3

:

3-(1,1-Dimethylethyl)-2,4-imidazolidinedione

Description:
3-(1,1-Dimethylethyl)-2,4-imidazolidinedione, commonly known as a derivative of imidazolidinedione, is a chemical compound characterized by its unique structure that includes a five-membered ring containing two nitrogen atoms. This compound typically exhibits properties such as being a white to off-white crystalline solid, which is relatively stable under standard conditions. It is soluble in organic solvents but may have limited solubility in water. The presence of the tert-butyl group (1,1-dimethylethyl) contributes to its hydrophobic characteristics, influencing its reactivity and interaction with other substances. This compound is often studied for its potential applications in pharmaceuticals and agrochemicals, particularly due to its ability to act as a building block in the synthesis of more complex molecules. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. As with many chemical substances, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards.
Formula:C7H12N2O2
InChI:InChI=1S/C7H12N2O2/c1-7(2,3)9-5(10)4-8-6(9)11/h4H2,1-3H3,(H,8,11)
InChI key:InChIKey=MJODWMWEKBBINL-UHFFFAOYSA-N
SMILES:C(C)(C)(C)N1C(=O)CNC1=O
Synonyms:
  • 3-tert-Butylimidazolidine-2,4-dione
  • 2,4-Imidazolidinedione, 3-(1,1-dimethylethyl)-
  • 3-(1,1-Dimethylethyl)-2,4-imidazolidinedione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.