CAS 931-03-3
:Pyrrole-3-carboxylic acid
Description:
Pyrrole-3-carboxylic acid is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing one nitrogen atom. This compound features a carboxylic acid functional group (-COOH) at the 3-position of the pyrrole ring, which contributes to its acidic properties. Pyrrole-3-carboxylic acid is typically a white to light yellow solid and is soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid group. It exhibits properties typical of both pyrrole derivatives and carboxylic acids, including potential reactivity in various chemical reactions, such as esterification and amidation. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in synthesizing more complex organic molecules. Additionally, it may serve as a building block in the synthesis of pharmaceuticals and agrochemicals. As with many organic compounds, handling should be done with care, following appropriate safety protocols.
Formula:C5H5NO2
InChI:InChI=1S/C5H5NO2/c7-5(8)4-1-2-6-3-4/h1-3,6H,(H,7,8)
InChI key:InChIKey=DOYOPBSXEIZLRE-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=CNC1
Synonyms:- 1H-Pyrrole-3-carboxylic acid
- 3-Carboxypyrrole
- Pyrrole-3-carboxylicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Pyrrole-3-carboxylic Acid
CAS:Formula:C5H5NO2Purity:>95.0%(GC)(T)Color and Shape:White to Light orange to Yellow powder to crystalMolecular weight:111.10Pyrrole-3-carboxylic acid, 98+%
CAS:Pyrrole-3-carboxylic acid is useful for the synthesis of cholecystokinin antagonists, benzopyran antihypertensives and azepinediones. It is utilized for the preparation of a poly(pyrrole-3-carboxylic acid) modified pencil graphite electrode and its usage in the determination of serotonin (SER) in blFormula:C5H5NO2Purity:98+%Color and Shape:Off-white to yellow, Powder or crystals or crystalline powderMolecular weight:111.10Pyrrole-3-Carboxilic acid
CAS:Formula:C5H5NO2Purity:88.44%Color and Shape:Brownish. SolidMolecular weight:111.01H-PYRROLE-3-CARBOXYLIC ACID HYDRATE
CAS:Formula:C5H5NO2Purity:95%Color and Shape:SolidMolecular weight:111.0987Ref: IN-DA003U36
100gTo inquire250gTo inquire500gTo inquire100mg22.00€250mg26.00€1g30.00€5g68.00€10g132.00€25g187.00€1H-Pyrrole-3-carboxylic acid
CAS:1H-Pyrrole-3-carboxylic acidPurity:97%Color and Shape:Beige PowderMolecular weight:111.10g/mol1H-Pyrrole-3-carboxylic acid
CAS:Formula:C5H5NO2Purity:95%Color and Shape:SolidMolecular weight:111.11-H-Pyrrole-3-carboxylic acid
CAS:The immobilized 1-H-pyrrole-3-carboxylic acid (1HP) is an amine that has been immobilized on a solid support. It is able to capture the growth factors and enzymes that are involved in immunoglobulin production and release. This immobilized 1HP has been used for the detection of albumin in urine samples, as well as for the determination of dopamine concentrations in blood plasma. The chemical composition of this immobilized 1HP has been determined by means of electrochemical impedance spectroscopy (EIS). The EIS results showed that it contains a few amines, which are responsible for its covalent linkages with the solid support.
Formula:C5H5NO2Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:111.1 g/mol







