CAS 931-10-2
:(1R,2R)-2-methylcyclohexanamine
Description:
(1R,2R)-2-methylcyclohexanamine, with the CAS number 931-10-2, is an organic compound characterized by its cyclohexane ring structure substituted with an amine group and a methyl group. This compound is a chiral amine, meaning it has two enantiomers due to the presence of a stereocenter at the carbon atom adjacent to the amine group. The (1R,2R) designation indicates the specific configuration of these stereocenters. It is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. The presence of the amine group imparts basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility in polar solvents and potential for hydrogen bonding are also notable characteristics, influencing its reactivity and interactions with other chemical species.
Formula:C7H15N
InChI:InChI=1/C7H15N/c1-6-4-2-3-5-7(6)8/h6-7H,2-5,8H2,1H3/t6-,7-/m1/s1
SMILES:C[C@@H]1CCCC[C@H]1N
Synonyms:- cyclohexanamine, 2-methyl-, (1R,2R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
