CymitQuimica logo

CAS 93103-15-2

:

4-(4-fluorophenyl)-1,3-dihydro-2H-imidazole-2-thione

Description:
4-(4-Fluorophenyl)-1,3-dihydro-2H-imidazole-2-thione, identified by its CAS number 93103-15-2, is a heterocyclic compound featuring an imidazole ring with a thione functional group. This compound is characterized by the presence of a fluorophenyl substituent, which can influence its chemical reactivity and biological activity. The imidazole ring contributes to its potential as a ligand in coordination chemistry and as a scaffold in medicinal chemistry, particularly in the development of pharmaceuticals. The thione group (–C=S) can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. Additionally, the fluorine atom in the para position of the phenyl ring can enhance lipophilicity and alter the electronic properties of the molecule, potentially affecting its interaction with biological targets. Overall, this compound's unique structural features make it of interest in various fields, including organic synthesis, medicinal chemistry, and materials science.
Formula:C9H7FN2S
InChI:InChI=1/C9H7FN2S/c10-7-3-1-6(2-4-7)8-5-11-9(13)12-8/h1-5H,(H2,11,12,13)
SMILES:c1cc(ccc1c1cnc([nH]1)S)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.