CAS 93103-29-8

4-pyridin-3-yl-1,3-dihydro-2H-imidazole-2-thione

Description:

4-Pyridin-3-yl-1,3-dihydro-2H-imidazole-2-thione is a heterocyclic compound characterized by its imidazole and pyridine moieties. This compound features a thione functional group, which is a sulfur-containing analogue of a ketone, contributing to its unique chemical reactivity and properties. It typically exhibits moderate solubility in polar organic solvents due to the presence of both nitrogen and sulfur atoms, which can engage in hydrogen bonding and coordination with metal ions. The compound may display biological activity, making it of interest in medicinal chemistry, particularly for its potential as a pharmacophore in drug development. Its structure allows for various substitution patterns, which can influence its reactivity and interaction with biological targets. Additionally, the presence of the pyridine ring can enhance its electron-withdrawing properties, affecting its overall stability and reactivity in chemical reactions. Overall, 4-pyridin-3-yl-1,3-dihydro-2H-imidazole-2-thione is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₈H₇N₃S

InChI: InChI=1/C8H7N3S/c12-8-10-5-7(11-8)6-2-1-3-9-4-6/h1-5H,(H2,10,11,12)

SMILES: c1cc(cnc1)c1cnc([nH]1)S

3-(2-Mercapto-1H-imidazol-4-yl)pyridine

Controlled Product

CAS: 93103-29-8

Applications 3-(2-Mercapto-1H-imidazol-4-yl)pyridine (cas# 93103-29-8 ) is a compound useful in organic synthesis.

Formula: C₈H₇N₃S

Color and Shape: Neat

Molecular weight: 177.23

Ref: TR-M225300