CymitQuimica logo

CAS 931115-27-4

:

(1R,2R)-2-(Aminomethyl)-1-(3-methoxyphenyl)cyclohexanol

Description:
(1R,2R)-2-(Aminomethyl)-1-(3-methoxyphenyl)cyclohexanol is a chemical compound characterized by its specific stereochemistry, indicated by the (1R,2R) configuration. This compound features a cyclohexanol ring, which contributes to its cyclic structure and potential for various interactions. The presence of an aminomethyl group suggests that it may exhibit basic properties, allowing it to participate in hydrogen bonding and potentially act as a ligand in coordination chemistry. The 3-methoxyphenyl substituent introduces an aromatic character, which can influence the compound's solubility, stability, and reactivity. This compound may be of interest in medicinal chemistry due to its structural features that could interact with biological targets. Its specific stereochemistry may also play a crucial role in determining its pharmacological activity and selectivity. Overall, (1R,2R)-2-(Aminomethyl)-1-(3-methoxyphenyl)cyclohexanol presents a unique combination of functional groups and structural characteristics that could be explored for various applications in research and development.
Formula:C14H21NO2
InChI:InChI=1S/C14H21NO2/c1-17-13-7-4-6-11(9-13)14(16)8-3-2-5-12(14)10-15/h4,6-7,9,12,16H,2-3,5,8,10,15H2,1H3/t12-,14+/m1/s1
InChI key:InChIKey=QNPPIKMBCJUUTG-OCCSQVGLSA-N
SMILES:O[C@]1([C@@H](CN)CCCC1)C2=CC(OC)=CC=C2
Synonyms:
  • (1R,2R)-2-(Aminomethyl)-1-(3-methoxyphenyl)cyclohexanol
  • Cyclohexanol, 2-(aminomethyl)-1-(3-methoxyphenyl)-, (1R,2R)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.