CymitQuimica logo

CAS 93113-11-2

:

2-[1,2,4]triazolo[4,3-a]pyridin-3-ylethanaminium

Description:
2-[1,2,4]triazolo[4,3-a]pyridin-3-ylethanaminium, with the CAS number 93113-11-2, is a chemical compound characterized by its unique structure that incorporates a triazole ring fused to a pyridine moiety. This compound typically exhibits properties associated with both heterocyclic compounds and amines, including potential basicity due to the presence of the aminium group. It may display solubility in polar solvents, which is common for amine-containing compounds, and could participate in hydrogen bonding due to the presence of nitrogen atoms in its structure. The compound's biological activity may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as triazole and pyridine derivatives are often associated with various biological activities. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular conformation. As with many heterocycles, it may also exhibit interesting electronic properties, making it a candidate for further research in organic synthesis and material science.
Formula:C8H11N4
InChI:InChI=1/C8H10N4/c9-5-4-8-11-10-7-3-1-2-6-12(7)8/h1-3,6H,4-5,9H2/p+1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.