CAS 93114-08-0
:N'-(1,1-dioxidotetrahydrothiophen-3-yl)-N,N-dimethylethane-1,2-diamine
Description:
N'-(1,1-dioxidotetrahydrothiophen-3-yl)-N,N-dimethylethane-1,2-diamine, with the CAS number 93114-08-0, is a chemical compound characterized by its unique structure that includes a tetrahydrothiophene ring and a dimethylated ethylene diamine moiety. This compound features a sulfur atom within the thiophene ring, contributing to its potential reactivity and interaction with various biological systems. The presence of the 1,1-dioxide functional group indicates that it may exhibit properties typical of sulfoxides or sulfones, which can influence its solubility and stability. The dimethylamine groups suggest that it may have basic properties, potentially allowing it to participate in various chemical reactions, including nucleophilic substitutions. Its molecular structure may also confer specific pharmacological activities, making it of interest in medicinal chemistry. Overall, this compound's characteristics, including its functional groups and structural features, suggest potential applications in pharmaceuticals or as a chemical intermediate in organic synthesis.
Formula:C8H18N2O2S
InChI:InChI=1/C8H18N2O2S/c1-10(2)5-4-9-8-3-6-13(11,12)7-8/h8-9H,3-7H2,1-2H3
SMILES:CN(C)CCNC1CCS(=O)(=O)C1
Synonyms:- 1,2-Ethanediamine, N~1~,N~1~-dimethyl-N~2~-(tetrahydro-1,1-dioxido-3-thienyl)-
- N'-(1,1-dioxidotetrahydrothien-3-yl)-N,N-dimethylethane-1,2-diamine
- N~1~-(1,1-dioxidotetrahydro-3-thienyl)-N~2~,N~2~-dimethyl-1,2-ethanediamine
- N'-(1,1-Dioxidotetrahydrothiophen-3-yl)-N,N-dimethylethane-1,2-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.