CAS 93117-07-8
:5-aminoisoquinolin-1(2H)-one hydrochloride
Description:
5-Aminoisoquinolin-1(2H)-one hydrochloride is a chemical compound characterized by its isoquinoline structure, which features an amino group and a carbonyl group. This compound is typically a white to off-white crystalline solid that is soluble in water and various organic solvents, making it useful in pharmaceutical applications. The presence of the amino group contributes to its potential as a building block in drug synthesis, particularly in the development of compounds with biological activity. The hydrochloride salt form enhances its stability and solubility, facilitating its use in various chemical reactions and formulations. Additionally, this compound may exhibit properties such as fluorescence, which can be advantageous in analytical chemistry. Its specific applications often relate to medicinal chemistry, where it may serve as a precursor or intermediate in the synthesis of more complex molecules. As with many chemical substances, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards associated with its use.
Formula:C9H9ClN2O
InChI:InChI=1/C9H8N2O.ClH/c10-8-3-1-2-7-6(8)4-5-11-9(7)12;/h1-5H,10H2,(H,11,12);1H
SMILES:c1cc2c(ccnc2O)c(c1)N.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-AIQ hydrochloride
CAS:Formula:C9H9ClN2OPurity:(HPLC) ≥ 98.0%Color and Shape:Off-white to beige or light brown powderMolecular weight:196.635-AIQ hydrochloride
CAS:5-AIQ hydrochloride is a water-soluble PARP-1 inhibitor and serves as a vital functional group in various medications. It mitigates tissue damage associated with hepatic ischemia-reperfusion, making it valuable for research into conditions related to liver ischemia-reperfusion.Formula:C9H9ClN2OColor and Shape:SolidMolecular weight:196.634


