CAS 93125-79-2
:N-cyclohexyl-3-nitrobenzenesulfonamide
Description:
N-cyclohexyl-3-nitrobenzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is attached to a nitro-substituted aromatic ring and a cyclohexyl group. This compound typically exhibits moderate solubility in organic solvents and limited solubility in water due to its hydrophobic cyclohexyl moiety. The presence of the nitro group contributes to its electron-withdrawing properties, which can influence its reactivity and interactions in chemical processes. N-cyclohexyl-3-nitrobenzenesulfonamide may be utilized in various applications, including medicinal chemistry, where sulfonamides are known for their antibacterial properties. Additionally, the compound's structure suggests potential for further derivatization, making it of interest in synthetic organic chemistry. Safety considerations should be taken into account, as compounds containing nitro and sulfonamide groups can pose health risks, necessitating proper handling and disposal procedures in laboratory settings.
Formula:C12H16N2O4S
InChI:InChI=1/C12H16N2O4S/c15-14(16)11-7-4-8-12(9-11)19(17,18)13-10-5-2-1-3-6-10/h4,7-10,13H,1-3,5-6H2
SMILES:C1CCC(CC1)NS(=O)(=O)C1=CC=CC(=C1)N(=O)=O
Synonyms:- benzenesulfonamide, N-cyclohexyl-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
