CAS 93129-38-5
:2-(trans-4-Ethylcyclohexyl)-1,3-propanediol
Description:
2-(trans-4-Ethylcyclohexyl)-1,3-propanediol, with the CAS number 93129-38-5, is an organic compound characterized by its unique structure that includes a cyclohexyl ring substituted with an ethyl group and a propanediol moiety. This compound typically exhibits properties such as being a colorless to pale yellow liquid, with a moderate viscosity and a relatively high boiling point compared to simpler alcohols. It is soluble in organic solvents and may have limited solubility in water due to its hydrophobic cyclohexyl component. The presence of hydroxyl groups in its structure contributes to its potential as a versatile intermediate in organic synthesis and as a potential plasticizer or additive in various formulations. Additionally, its unique structural features may impart specific physical and chemical properties, such as stability under various conditions and potential reactivity with other chemical species. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance.
Formula:C11H22O2
InChI:InChI=1/C11H22O2/c1-2-9-3-5-10(6-4-9)11(7-12)8-13/h9-13H,2-8H2,1H3/t9-,10-
InChI key:InChIKey=BAFHGLCZZGNMDM-MGCOHNPYNA-N
SMILES:C(CO)(CO)[C@H]1CC[C@H](CC)CC1
Synonyms:- 1,3-Propanediol, 2-(4-ethylcyclohexyl)-, trans-
- 2-(TRANS-4’-ETHYL-CYCLOHEXYL)-PROPANE-1,3-DIOL
- 2-(trans-4-Ethylcyclohexyl)-1,3-propanediol
- 1,3-Propanediol, 2-(trans-4-ethylcyclohexyl)-
- 2-(trans-4-Ethylcyclohexyl)propane-1,3-diol
- 2-(TRANS-4-ETHYLCYCLOHEXYL)PROPANE-1,3-DIOL
- 2-(4-Ethylcyclohexyl)propane-1,3-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.