CAS 93129-41-0

{[(3,4-dimethoxyphenyl)sulfonyl]amino}acetate

Description:

The chemical substance known as {(3,4-dimethoxyphenyl)sulfonyl]amino}acetate, with the CAS number 93129-41-0, is characterized by its unique structural features and functional groups. It contains a sulfonamide group, which is known for its ability to form hydrogen bonds and participate in various chemical reactions. The presence of the 3,4-dimethoxyphenyl moiety contributes to its aromatic characteristics, potentially influencing its solubility and reactivity. The acetate group suggests that it can act as an acid or a base, depending on the pH of the environment. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its solubility, stability, and reactivity can be influenced by the substituents on the aromatic ring and the sulfonamide group. Overall, this compound's properties make it a candidate for further investigation in various chemical and biological applications.

Formula: C₁₀H₁₂NO₆S

InChI: InChI=1/C10H13NO6S/c1-16-8-4-3-7(5-9(8)17-2)18(14,15)11-6-10(12)13/h3-5,11H,6H2,1-2H3,(H,12,13)/p-1

SMILES: COc1ccc(cc1OC)S(=O)(=O)NCC(=O)[O-]

2-(3,4-Dimethoxybenzenesulfonamido)acetic acid

CAS: 93129-41-0

Versatile small molecule scaffold

Formula: C₁₀H₁₃NO₆S

Purity: Min. 95%

Molecular weight: 275.28 g/mol

Ref: 3D-TDA12941