CAS 93133-76-7
:D-myo-inositol 1,3,4-tris-*phosphate ammonium
Description:
D-myo-inositol 1,3,4-trisphosphate ammonium, with the CAS number 93133-76-7, is a phosphorylated inositol derivative that plays a significant role in cellular signaling pathways. It is a water-soluble compound, which allows it to easily interact with various biological systems. The substance is characterized by its ability to act as a second messenger in signal transduction, particularly in the regulation of calcium release from intracellular stores. This compound is involved in various physiological processes, including cell growth, differentiation, and metabolism. Its structure features a myo-inositol backbone with three phosphate groups attached at the 1, 3, and 4 positions, which contributes to its biological activity. The ammonium form indicates the presence of an ammonium ion, which may enhance its solubility and stability in aqueous environments. Overall, D-myo-inositol 1,3,4-trisphosphate ammonium is a crucial molecule in biochemistry, particularly in the context of cellular communication and metabolic regulation.
Formula:C6H15O15P3
InChI:InChI=1/C6H15O15P3/c7-1-2(8)5(20-23(13,14)15)6(21-24(16,17)18)3(9)4(1)19-22(10,11)12/h1-9H,(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)
SMILES:C1(C(C(C(C(C1OP(=O)(O)O)O)OP(=O)(O)O)OP(=O)(O)O)O)O
Synonyms:- 3,5,6-Trihydroxycyclohexane-1,2,4-Triyl Tris[Dihydrogen (Phosphate)]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
