CAS 93138-56-8

4-Piperidinamine, 1-methyl-2-phenyl-, hydrochloride (1:2)

Description:

4-Piperidinamine, 1-methyl-2-phenyl-, hydrochloride (1:2), with the CAS number 93138-56-8, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a phenyl group and a methyl group attached to the piperidine nitrogen, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the amine functional group suggests potential basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. This compound may exhibit biological activity, making it of interest in medicinal chemistry for the development of therapeutic agents. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the conditions under which it is studied or utilized. Safety data should be consulted to ensure proper handling and usage in laboratory or industrial settings.

Formula: C₁₂H₁₈N₂·2ClH

InChI: InChI=1S/C12H18N2.2ClH/c1-14-8-7-11(13)9-12(14)10-5-3-2-4-6-10;;/h2-6,11-12H,7-9,13H2,1H3;2*1H

InChI key: InChIKey=BYUIDCLGSUXRGT-UHFFFAOYSA-N

SMILES: CN1C(CC(N)CC1)C2=CC=CC=C2.Cl

Synonyms:

• 4-Piperidinamine, 1-methyl-2-phenyl-, hydrochloride (1:2)
• Piperidine, 4-amino-1-methyl-2-phenyl-, dihydrochloride
• 1-Methyl-2-phenylpiperidin-4-amine dihydrochloride