
CAS 931581-80-5
:2-(3-Azetidinylthio)benzothiazole
Description:
2-(3-Azetidinylthio)benzothiazole is a chemical compound characterized by its unique structural features, which include a benzothiazole moiety and an azetidine ring linked through a thioether group. The benzothiazole part contributes to its aromatic properties and potential biological activity, while the azetidine ring introduces a cyclic amine structure that may influence its reactivity and interaction with biological targets. This compound is typically classified as a heterocyclic organic compound, and its thioether linkage may enhance its solubility and stability in various solvents. The presence of sulfur in the thiazole ring can also impart specific electronic properties, making it of interest in medicinal chemistry and drug development. Compounds like this are often investigated for their potential pharmacological activities, including antimicrobial, anti-inflammatory, or anticancer properties. However, detailed studies on its specific biological effects and applications would be necessary to fully understand its potential uses in pharmaceuticals or other fields.
Formula:C10H10N2S2
InChI:InChI=1S/C10H10N2S2/c1-2-4-9-8(3-1)12-10(14-9)13-7-5-11-6-7/h1-4,7,11H,5-6H2
InChI key:InChIKey=PLHUCXIUSSCNBB-UHFFFAOYSA-N
SMILES:S(C1=NC=2C(S1)=CC=CC2)C3CNC3
Synonyms:- Benzothiazole, 2-(3-azetidinylthio)-
- 2-(Azetidin-3-ylsulfanyl)-1,3-benzothiazole
- 2-(3-Azetidinylthio)benzothiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.