CAS 93185-32-1

ethyl 2-(benzylsulfanyl)-6-oxo-1,6-dihydropyrimidine-5-carboxylate

Description:

Ethyl 2-(benzylsulfanyl)-6-oxo-1,6-dihydropyrimidine-5-carboxylate is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a benzylsulfanyl group and an ethyl ester functional group. This compound typically exhibits properties associated with both heterocyclic compounds and esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbonyl and ester functionalities. The benzylsulfanyl group may impart specific electronic and steric effects, influencing the compound's reactivity and interactions in biological systems. Additionally, compounds of this type may exhibit pharmacological activities, making them of interest in medicinal chemistry. The presence of the dihydropyrimidine structure suggests potential applications in the development of pharmaceuticals, particularly in areas related to anti-inflammatory or antimicrobial agents. Overall, ethyl 2-(benzylsulfanyl)-6-oxo-1,6-dihydropyrimidine-5-carboxylate represents a versatile scaffold for further chemical modifications and investigations in various fields of research.

Formula: C₁₄H₁₄N₂O₃S

InChI: InChI=1/C14H14N2O3S/c1-2-19-13(18)11-8-15-14(16-12(11)17)20-9-10-6-4-3-5-7-10/h3-8H,2,9H2,1H3,(H,15,16,17)

SMILES: CCOC(=O)c1cnc(nc1O)SCc1ccccc1