CAS 93189-07-2

3-[(phenylamino)methyl]phenol

Description:

3-[(Phenylamino)methyl]phenol, also known by its CAS number 93189-07-2, is an organic compound characterized by the presence of a phenolic hydroxyl group and an amino group attached to a phenyl ring. This compound features a central phenol structure with a phenylamino group (an amino group attached to a phenyl ring) linked through a methylene (-CH2-) bridge. The presence of both the hydroxyl and amino functional groups contributes to its potential as a versatile intermediate in organic synthesis, particularly in the development of dyes, pharmaceuticals, and agrochemicals. The compound is likely to exhibit moderate solubility in polar solvents due to the hydroxyl group, while the phenyl groups may enhance its hydrophobic characteristics. Additionally, the amino group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Overall, 3-[(Phenylamino)methyl]phenol is of interest in various chemical applications due to its unique structural features and functional properties.

Formula: C₁₃H₁₃NO

InChI: InChI=1/C13H13NO/c15-13-8-4-5-11(9-13)10-14-12-6-2-1-3-7-12/h1-9,14-15H,10H2

SMILES: c1ccc(cc1)NCc1cccc(c1)O