CAS 93195-32-5
:[5-[4-Hydroxy-3-(8-hydroxy-2,5,9-trimethyl-1-oxo-2,4,9,12-tetradecatetrenyl)-2-oxo-2H-pyran-6-yl]-1-hexenyl]carbamic acid methyl ester
Description:
The chemical substance known as "[5-[4-Hydroxy-3-(8-hydroxy-2,5,9-trimethyl-1-oxo-2,4,9,12-tetradecatetrenyl)-2-oxo-2H-pyran-6-yl]-1-hexenyl]carbamic acid methyl ester," with the CAS number 93195-32-5, is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including a carbamic acid ester, which contributes to its reactivity and potential biological activity. The presence of a pyran ring and a long hydrocarbon chain suggests that it may exhibit lipophilic properties, potentially influencing its solubility and interaction with biological membranes. Additionally, the hydroxyl groups in its structure may impart hydrogen-bonding capabilities, enhancing its interactions in various chemical environments. This compound may be of interest in fields such as medicinal chemistry or agrochemicals, where its unique structure could lead to specific biological activities or applications. However, detailed studies would be necessary to fully elucidate its properties, including its stability, reactivity, and potential uses.
Formula:C31H43NO7
InChI:InChI=1/C31H43NO7/c1-7-8-9-10-13-22(3)25(33)18-16-21(2)15-17-24(5)29(35)28-26(34)20-27(39-30(28)36)23(4)14-11-12-19-32-31(37)38-6/h7-8,12-13,15,17,19-20,23,25,33,36H,9-11,14,16,18H2,1-6H3,(H,32,37)/b8-7+,19-12+,21-15+,22-13-,24-17+
Synonyms:- [5-[4-Hydroxy-3-(8-hydroxy-2,5,9-trimethyl-1-oxo-2,4,9,12-tetradecatetrenyl)-2-oxo-2H-pyran-6-yl]-1-hexenyl]carbamic acid methyl ester
- Corallopyronin A'
- Corallopyronin
- Corallopyronin A
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Corallopyronin A
CAS:Corallopyronin A is an antibiotic that can be isolated from *Corallococcus coralloides* [1].Formula:C30H41NO7Color and Shape:SolidMolecular weight:527.65
