
CAS 93198-73-3
:2,3-Dihydro-7-methoxy-3-benzofuranacetic acid
Description:
2,3-Dihydro-7-methoxy-3-benzofuranacetic acid, identified by its CAS number 93198-73-3, is a chemical compound that belongs to the class of benzofuran derivatives. This substance features a benzofuran ring system, which is characterized by a fused benzene and furan ring, contributing to its unique chemical properties. The presence of a methoxy group (-OCH3) at the 7-position enhances its lipophilicity and may influence its biological activity. The acetic acid moiety suggests potential for interactions with biological systems, possibly indicating its role in medicinal chemistry or as a pharmacophore. The compound is likely to exhibit moderate solubility in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the benzofuran structure. Additionally, the compound may possess interesting pharmacological properties, warranting further investigation into its potential applications in drug development or as a biochemical probe. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C11H12O4
InChI:InChI=1S/C11H12O4/c1-14-9-4-2-3-8-7(5-10(12)13)6-15-11(8)9/h2-4,7H,5-6H2,1H3,(H,12,13)
InChI key:InChIKey=YBXAMIJYESDTBM-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1C=2C(=C(OC)C=CC2)OC1
Synonyms:- 2-(7-Methoxy-2,3-dihydro-1-benzofuran-3-yl)acetic acid
- 3-Benzofuranacetic acid, 2,3-dihydro-7-methoxy-
- 2-(2,3-Dihydro-7-methoxybenzo[b]furan-3-yl)acetic acid
- 2,3-Dihydro-7-methoxy-3-benzofuranacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.