CAS 932-62-7
:3-acetyl-1-methylpyrrole
Description:
3-Acetyl-1-methylpyrrole is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing one nitrogen atom. This compound features an acetyl group at the 3-position and a methyl group at the 1-position of the pyrrole ring. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the acetyl group contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. The compound is soluble in organic solvents and exhibits moderate stability under standard conditions. Its chemical properties include the ability to undergo various reactions such as electrophilic substitution and condensation, which are common in compounds containing heterocycles. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 3-acetyl-1-methylpyrrole is a valuable compound in synthetic organic chemistry due to its unique structural features and reactivity.
Formula:C7H9NO
InChI:InChI=1/C7H9NO/c1-6(9)7-3-4-8(2)5-7/h3-5H,1-2H3
SMILES:CC(=O)c1ccn(C)c1
Synonyms:- Acetylmethylpyrrole
- 1-(1-methyl-1H-pyrrol-3-yl)ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-(1-Methyl-1H-pyrrol-3-yl)ethanone
CAS:Formula:C7H9NOColor and Shape:LiquidMolecular weight:123.15253-Acetyl-1-methylpyrrole
CAS:3-Acetyl-1-methylpyrrole is an activating agent that can be used to synthesize methyl ketones. It has been shown to react with acid solutions and proton, which are generated by the reaction of a metal ion (such as Al) with hydrochloric acid. This reaction leads to the formation of enolate ions, which can then react with carbonyl groups to form alkylation products. 3-Acetyl-1-methylpyrrole is also able to catalyze reactions in both acidic and basic conditions. The kinetic of this reaction is fast, efficient, and does not require expensive equipment.
Formula:C7H9NOPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:123.15 g/mol


