CAS 93201-36-6
:1-(5-acetyl-2-methoxybenzyl)piperidinium
Description:
1-(5-acetyl-2-methoxybenzyl)piperidinium is a chemical compound characterized by its piperidinium structure, which includes a piperidine ring substituted with a benzyl group that has an acetyl and a methoxy group. This compound typically exhibits properties associated with both piperidine derivatives and aromatic compounds, such as moderate solubility in organic solvents and potential biological activity. The presence of the acetyl group may contribute to its reactivity and ability to participate in various chemical reactions, while the methoxy group can influence its electronic properties and steric hindrance. The compound may also exhibit polar characteristics due to the functional groups, affecting its interactions in biological systems. Its specific applications and behavior in chemical reactions would depend on the context of its use, including potential roles in medicinal chemistry or as a synthetic intermediate. As with many organic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity.
Formula:C15H22NO2
InChI:InChI=1/C15H21NO2/c1-12(17)13-6-7-15(18-2)14(10-13)11-16-8-4-3-5-9-16/h6-7,10H,3-5,8-9,11H2,1-2H3/p+1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-[4-Methoxy-3-(piperidin-1-ylmethyl)phenyl]ethan-1-one
CAS:1-[4-Methoxy-3-(piperidin-1-ylmethyl)phenyl]ethan-1-one is a phenolic compound with a hydroxyl group on the surface of the molecule. This product can be used as an additive in cosmetics and personal care products. It has been shown to be photoreactive and to initiate polymerization reactions. This product is also able to create magnetic particles when mixed with a magnetic material, such as iron oxide or cobalt ferrite. The magnetic properties of this additive make it useful for various applications, including use in magnetic particle imaging (MPI) procedures and as an additive in polymerization processes.Formula:C15H21NO2Purity:Min. 95%Molecular weight:247.33 g/mol
