CAS 932033-58-4
:[2,2′-Binaphthalene]-6,6′-dicarboxylic acid
Description:
[2,2′-Binaphthalene]-6,6′-dicarboxylic acid is an organic compound characterized by its unique structure, which consists of two naphthalene units connected by a central carbon atom, with carboxylic acid functional groups at the 6 and 6' positions. This compound exhibits properties typical of polycyclic aromatic compounds, including potential for strong π-π stacking interactions due to its planar structure. The presence of carboxylic acid groups contributes to its solubility in polar solvents and enhances its reactivity, allowing for potential applications in organic synthesis and materials science. Additionally, the compound may exhibit interesting optical properties, making it a candidate for use in organic electronics or as a building block in supramolecular chemistry. Its ability to form hydrogen bonds due to the carboxylic acid groups can also facilitate interactions with other molecules, which is valuable in the development of functional materials. Overall, [2,2′-Binaphthalene]-6,6′-dicarboxylic acid is a versatile compound with potential applications in various fields of chemistry.
Formula:C22H14O4
InChI:InChI=1S/C22H14O4/c23-21(24)19-7-5-15-9-13(1-3-17(15)11-19)14-2-4-18-12-20(22(25)26)8-6-16(18)10-14/h1-12H,(H,23,24)(H,25,26)
InChI key:InChIKey=HWEIPTRZTZNYNO-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC2=C(C=C(C=C2)C3=CC4=C(C=C3)C=C(C(O)=O)C=C4)C=C1
Synonyms:- 2,2′-Binaphthyl-6,6′-dicarboxylic acid
- [2,2′-Binaphthalene]-6,6′-dicarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Adapalene Related Compound E (2,2'-Binaphthyl-6,6'-dicarboxylic acid)
CAS:Unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives, nesoiFormula:C22H14O4Color and Shape:PowderMolecular weight:342.089212,2'-Binaphthalene-6,6'-dicarboxylic Acid
CAS:Formula:C22H14O4Purity:98%Color and Shape:SolidMolecular weight:342.3442Adapalene EP Impurity A (Adapalene USP Related Compound E)
CAS:Formula:C22H14O4Molecular weight:342.35[2,2'-Binaphthalene]-6,6'-dicarboxylic acid
CAS:[2,2'-Binaphthalene]-6,6'-dicarboxylic acidPurity:98%Molecular weight:342.34g/mol2,2'-Binaphthalene-6,6'-dicarboxylic Acid
CAS:Controlled ProductFormula:C22H14O4Color and Shape:NeatMolecular weight:342.342,2'-Binaphthalene-6,6'-dicarboxylic Acid
CAS:Controlled ProductFormula:C22H14O4Color and Shape:NeatMolecular weight:342.342,2'-Binaphthalene-6,6'-dicarboxylic acid
CAS:2,2'-Binaphthalene-6,6'-dicarboxylic acid is an analytical standard that can be used to measure the purity of a drug product. It has been shown to be a metabolite of a number of drugs that have been studied in metabolism studies. It is also used as an impurity standard for HPLC analysis and as an API impurity for drug development. 2,2'-Binaphthalene-6,6'-dicarboxylic acid is synthesized from natural or synthetic sources and is available in high purity.Formula:C22H14O4Purity:Min. 95%Molecular weight:342.3 g/mol









