
CAS 932042-99-4
:2-Bromo-3-(methoxymethyl)pyridine
Description:
2-Bromo-3-(methoxymethyl)pyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a bromine atom and a methoxymethyl group. The bromine atom introduces a halogen functionality, which can enhance the compound's reactivity, particularly in nucleophilic substitution reactions. The methoxymethyl group, consisting of a methoxy (-OCH3) and a methyl (-CH2-) moiety, contributes to the compound's overall polarity and solubility in organic solvents. This compound is typically used in organic synthesis and medicinal chemistry, where its unique structural features may facilitate the development of biologically active molecules. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug discovery. Additionally, the presence of both the bromine and methoxymethyl groups can influence the compound's physical properties, such as boiling point and melting point, as well as its reactivity in various chemical reactions. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.
Formula:C7H8BrNO
InChI:InChI=1S/C7H8BrNO/c1-10-5-6-3-2-4-9-7(6)8/h2-4H,5H2,1H3
InChI key:InChIKey=VUFHXGCSXOQFOQ-UHFFFAOYSA-N
SMILES:C(OC)C1=C(Br)N=CC=C1
Synonyms:- 2-Bromo-3-(methoxymethyl)pyridine
- Pyridine, 2-bromo-3-(methoxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.