CymitQuimica logo

CAS 93207-22-8

:

crabrolin

Description:
Crabrolin, identified by its CAS number 93207-22-8, is a chemical compound that belongs to the class of substances known as herbicides. It is primarily utilized in agricultural settings for its effectiveness in controlling various types of weeds. The compound exhibits selective herbicidal properties, which means it can target specific plant species while minimizing harm to desirable crops. Crabrolin functions by inhibiting certain biochemical pathways essential for plant growth, thereby disrupting the normal development of the targeted weeds. Its application typically involves pre-emergent or post-emergent treatment, depending on the specific agricultural needs. As with many chemical substances, safety precautions are necessary when handling crabrolin, as it may pose risks to human health and the environment if not used according to guidelines. Additionally, its environmental persistence and potential for bioaccumulation are factors that warrant careful consideration in its application and regulation. Overall, crabrolin represents a significant tool in modern agriculture, contributing to effective weed management strategies.
Formula:C74H130N18O14
InChI:InChI=1/C74H130N18O14/c1-17-44(13)58(90-67(100)54(36-41(7)8)85-68(101)56-30-25-33-92(56)73(106)55(37-42(9)10)87-63(96)49(76)38-48-26-20-19-21-27-48)70(103)86-53(35-40(5)6)66(99)83-51(29-24-32-80-74(78)79)64(97)82-50(28-22-23-31-75)65(98)89-59(45(14)18-2)71(104)88-57(43(11)12)69(102)91-60(47(16)93)72(105)81-46(15)62(95)84-52(61(77)94)34-39(3)4/h19-21,26-27,39-47,49-60,93H,17-18,22-25,28-38,75-76H2,1-16H3,(H2,77,94)(H,81,105)(H,82,97)(H,83,99)(H,84,95)(H,85,101)(H,86,103)(H,87,96)(H,88,104)(H,89,98)(H,90,100)(H,91,102)(H4,78,79,80)/t44-,45-,46-,47+,49-,50-,51-,52-,53-,54-,55-,56-,57-,58-,59-,60-/m0/s1
Synonyms:
  • L-Leucinamide, L-phenylalanyl-L-leucyl-L-prolyl-L-leucyl-L-isoleucyl-L-leucyl-L-arginyl-L-lysyl-L-isoleucyl-L-valyl-L-threonyl-L-alanyl-
  • crabrolin
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Crabrolin

    CAS:
    <p>Crabrolin is a 13-peptide that can be extracted from the venom of the European hornet (Vespa crabro). Its minimum inhibitory concentration/minimum bactericidal concentration (MIC/MBC) values against Staphylococcus aureus (S. aureus) (NCTC 10788), methicillin-resistant Staphylococcus aureus (MRSA) (NCTC 12493), and Enterococcus faecium (E. faecium) (NTCC 12697) are 2/2, 16/64, and 4/8 μM, respectively.</p>
    Formula:C74H130N18O14
    Color and Shape:Solid
    Molecular weight:1495.94