CAS 93211-24-6

3-[(1-methyl-1H-tetrazol-5-yl)sulfanyl]propanoic acid

Description:

3-[(1-Methyl-1H-tetrazol-5-yl)sulfanyl]propanoic acid, identified by its CAS number 93211-24-6, is a chemical compound that features a propanoic acid backbone substituted with a sulfanyl group linked to a 1-methyl-1H-tetrazole moiety. This compound is characterized by its unique structural components, which include a five-membered tetrazole ring that contributes to its potential biological activity and solubility properties. The presence of the sulfanyl group may enhance its reactivity and influence its interactions with biological targets. As a carboxylic acid, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The tetrazole ring is known for its role in medicinal chemistry, often exhibiting pharmacological properties such as antimicrobial and anti-inflammatory effects. Overall, this compound's distinct functional groups and structural features make it of interest in both synthetic chemistry and potential therapeutic applications.

Formula: C₅H₈N₄O₂S

InChI: InChI=1/C5H8N4O2S/c1-9-5(6-7-8-9)12-3-2-4(10)11/h2-3H2,1H3,(H,10,11)

SMILES: Cn1c(nnn1)SCCC(=O)O

Synonyms:

• propanoic acid, 3-[(1-methyl-1H-tetrazol-5-yl)thio]-