CAS 93211-49-5
:4-bromo-2,7-dimethoxy-3H-phenothiazin-3-one
Description:
4-Bromo-2,7-dimethoxy-3H-phenothiazin-3-one is a chemical compound belonging to the phenothiazine class, characterized by its tricyclic structure that includes a sulfur atom and nitrogen in the heterocyclic ring. This compound features a bromine atom and two methoxy groups (-OCH3) at specific positions on the phenothiazine framework, which can influence its chemical reactivity and biological activity. The presence of the bromine substituent may enhance its lipophilicity, potentially affecting its pharmacokinetic properties. The methoxy groups can also contribute to the compound's solubility and stability. Typically, phenothiazines are known for their applications in medicinal chemistry, particularly as antipsychotic agents, and may exhibit various biological activities, including antimicrobial and anti-inflammatory effects. The specific characteristics of 4-bromo-2,7-dimethoxy-3H-phenothiazin-3-one, such as its melting point, solubility, and spectral properties, would be determined through experimental methods and may vary based on the conditions of synthesis and purification.
Formula:C14H10BrNO3S
InChI:InChI=1/C14H10BrNO3S/c1-18-7-3-4-8-11(5-7)20-14-9(16-8)6-10(19-2)13(17)12(14)15/h3-6H,1-2H3
Synonyms:- 3H-phenothiazin-3-one, 4-bromo-2,7-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
L-651392
CAS:<p>L-651392 is an inhibitor of leukotriene.</p>Formula:C14H10BrNO3SColor and Shape:SolidMolecular weight:352.2
