
CAS 932114-30-2
:5-Formyl-N-methyl-3-pyridinecarboxamide
Description:
5-Formyl-N-methyl-3-pyridinecarboxamide, with the CAS number 932114-30-2, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a formyl group (-CHO) and a methylamide group (-N-methyl) attached to the pyridine ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the formyl group suggests that it can participate in various chemical reactions, such as condensation and reduction, making it useful in the synthesis of more complex molecules. Additionally, the N-methyl group can influence the compound's solubility and biological activity. The compound is likely to be a solid at room temperature and may exhibit moderate polarity due to the functional groups present. Its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, 5-Formyl-N-methyl-3-pyridinecarboxamide is of interest in medicinal chemistry and material science for its potential utility in various chemical transformations.
Formula:C8H8N2O2
InChI:InChI=1S/C8H8N2O2/c1-9-8(12)7-2-6(5-11)3-10-4-7/h2-5H,1H3,(H,9,12)
InChI key:InChIKey=HKVLXHZWMWVOGG-UHFFFAOYSA-N
SMILES:C(NC)(=O)C=1C=C(C=O)C=NC1
Synonyms:- 5-Formyl-N-methyl-3-pyridinecarboxamide
- 3-Pyridinecarboxamide, 5-formyl-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.