CAS 93215-41-9
:N-[(2S,3S,4R,5S)-2-benzyloxy-5-hydroxy-6-(hydroxymethyl)-4-methoxy-tetrahydropyran-3-yl]acetamide
Description:
N-[(2S,3S,4R,5S)-2-benzyloxy-5-hydroxy-6-(hydroxymethyl)-4-methoxy-tetrahydropyran-3-yl]acetamide, with CAS number 93215-41-9, is a complex organic compound characterized by its specific stereochemistry and functional groups. This substance features a tetrahydropyran ring, which is a six-membered cyclic ether, and is substituted with various functional groups, including a benzyloxy group, hydroxymethyl, and methoxy groups, contributing to its chemical reactivity and potential biological activity. The presence of the acetamide moiety suggests that it may exhibit properties typical of amides, such as stability under physiological conditions and potential interactions with biological targets. Its stereochemical configuration indicates that it may have specific interactions in biological systems, which could be relevant for pharmacological applications. Overall, this compound's unique structure and functional groups make it a subject of interest in medicinal chemistry and related fields.
Formula:C16H23NO6
InChI:InChI=1/C16H23NO6/c1-10(19)17-13-15(21-2)14(20)12(8-18)23-16(13)22-9-11-6-4-3-5-7-11/h3-7,12-16,18,20H,8-9H2,1-2H3,(H,17,19)/t12?,13-,14+,15+,16-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Benzyl 2-Acetamido-3-O-methyl-α-D-glucopyranoside
CAS:Controlled Product<p>Applications Benzyl 2-Acetamido-3-O-methyl-α-D-glucopyranoside (cas# 93215-41-9) is a compound useful in organic synthesis.<br></p>Formula:C16H23NO6Color and Shape:NeatMolecular weight:325.36Benzyl 2-acetamido-2-deoxy-3-O-methyl-a-D-glucopyranoside
CAS:<p>Benzyl 2-acetamido-2-deoxy-3-O-methyl-a-D-glucopyranoside is a fluorinated monosaccharide that has been synthesized and Oligosaccharides. It is a complex carbohydrate and can be used in the synthesis of glycosylation, polysaccharide, or click modification. The CAS No. 93215-41-9 is custom synthesis with high purity and good quality.</p>Formula:C16H23NO6Purity:Min. 95%Molecular weight:325.36 g/mol


