CAS 932186-53-3

N-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)acetamide

Description:

N-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)acetamide is an organic compound characterized by its unique pyrrole structure, which features a five-membered aromatic ring containing nitrogen. This compound includes a formyl group (-CHO) and an acetamide group (-C(=O)NH2), contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of two methyl groups at the 2 and 5 positions of the pyrrole ring enhances its lipophilicity and may influence its biological activity. The compound's molecular structure suggests it could participate in various chemical reactions, such as nucleophilic additions or condensation reactions, making it a candidate for further exploration in drug development or as a building block in synthetic chemistry. Additionally, its specific functional groups may impart interesting properties, such as solubility in polar solvents and potential interactions with biological targets. Overall, N-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)acetamide represents a versatile compound with implications in both research and application.

Formula: C₉H₁₂N₂O₂

InChI: InChI=1/C9H12N2O2/c1-6-4-9(5-12)7(2)11(6)10-8(3)13/h4-5H,1-3H3,(H,10,13)

SMILES: Cc1cc(C=O)c(C)n1N=C(C)O

N-(3-Formyl-2,5-dimethyl-1H-pyrrol-1-yl)acetamide

CAS: 932186-53-3

N-(3-Formyl-2,5-dimethyl-1H-pyrrol-1-yl)acetamide

Purity: 95%

Molecular weight: 180.20g/mol

Ref: 54-OR918721